C34H45Cl3GeN3 — CID 139142727
CID 139142727 (PubChem CID 139142727) has the molecular formula C34H45Cl3GeN3 and a molecular weight of 674.72 g/mol.
| Compound Name | CID 139142727 |
|---|---|
| PubChem CID | 139142727 |
| Molecular Formula | C34H45Cl3GeN3 |
| Molecular Weight | 674.72 g/mol |
| Exact Mass | 674.19 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1[NH-].Cc1ccccc1.Cl[Ge](Cl)Cl |
| InChI | InChI=1S/C27H37N3.C7H8.Cl3Ge/c1-17(2)21-11-9-12-22(18(3)4)25(21)29-15-16-30(27(29)28)26-23(19(5)6)13-10-14-24(26)20(7)8;1-7-5-3-2-4-6-7;1-4(2)3/h9-20,28H,1-8H3;2-6H,1H3; |
| InChIKey | DJJBKDCVTOGAGP-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 32.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.72 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|