C40H54ClN3O4 — CID 139232834
1-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-N-[2,6-di(propan-2-yl)phenyl]methanimine perchlorate (PubChem CID 139232834) has the molecular formula C40H54ClN3O4 and a molecular weight of 676.34 g/mol. Its IUPAC name is 1-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-N-[2,6-di(propan-2-yl)phenyl]methanimine perchlorate.
| Compound Name | 1-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-N-[2,6-di(propan-2-yl)phenyl]methanimine perchlorate |
|---|---|
| PubChem CID | 139232834 |
| Molecular Formula | C40H54ClN3O4 |
| Molecular Weight | 676.34 g/mol |
| Exact Mass | 675.38 |
| IUPAC Name | 1-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-N-[2,6-di(propan-2-yl)phenyl]methanimine perchlorate |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/c1n(-c2c(C(C)C)cccc2C(C)C)cc[n+]1-c1c(C(C)C)cccc1C(C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C40H54N3.ClHO4/c1-25(2)31-16-13-17-32(26(3)4)38(31)41-24-37-42(39-33(27(5)6)18-14-19-34(39)28(7)8)22-23-43(37)40-35(29(9)10)20-15-21-36(40)30(11)12;2-1(3,4)5/h13-30H,1-12H3;(H,2,3,4,5)/q+1;/p-1/b41-24+; |
| InChIKey | PQSMYQVPPBCSMS-PRJJWYMSSA-M |
| XLogP | 6.49 |
| TPSA | 113.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.34 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|