C35H45IN2 — CID 46189433
1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[(4-methylphenyl)methyl]imidazol-1-ium iodide (PubChem CID 46189433) has the molecular formula C35H45IN2 and a molecular weight of 620.66 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[(4-methylphenyl)methyl]imidazol-1-ium iodide.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[(4-methylphenyl)methyl]imidazol-1-ium iodide |
|---|---|
| PubChem CID | 46189433 |
| Molecular Formula | C35H45IN2 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[(4-methylphenyl)methyl]imidazol-1-ium iodide |
| SMILES | Cc1ccc(Cc2n(-c3c(C(C)C)cccc3C(C)C)cc[n+]2-c2c(C(C)C)cccc2C(C)C)cc1.[I-] |
| InChI | InChI=1S/C35H45N2.HI/c1-23(2)29-12-10-13-30(24(3)4)34(29)36-20-21-37(33(36)22-28-18-16-27(9)17-19-28)35-31(25(5)6)14-11-15-32(35)26(7)8;/h10-21,23-26H,22H2,1-9H3;1H/q+1;/p-1 |
| InChIKey | GAJBINDSYULAIZ-UHFFFAOYSA-M |
| XLogP | 6.15 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|