C28H36N2OS — CID 56931456
1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-carbothioate (PubChem CID 56931456) has the molecular formula C28H36N2OS and a molecular weight of 448.68 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-carbothioate.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-carbothioate |
|---|---|
| PubChem CID | 56931456 |
| Molecular Formula | C28H36N2OS |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-carbothioate |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1C(=O)[S-] |
| InChI | InChI=1S/C28H36N2OS/c1-17(2)21-11-9-12-22(18(3)4)25(21)29-15-16-30(27(29)28(31)32)26-23(19(5)6)13-10-14-24(26)20(7)8/h9-20H,1-8H3 |
| InChIKey | SHTKPIYZPRXCAS-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|