C41H52F4N2Si — CID 139102233
[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-tetrafluorosilanuide;toluene (PubChem CID 139102233) has the molecular formula C41H52F4N2Si and a molecular weight of 676.96 g/mol. Its IUPAC name is [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-tetrafluorosilanuide;toluene.
| Compound Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-tetrafluorosilanuide;toluene |
|---|---|
| PubChem CID | 139102233 |
| Molecular Formula | C41H52F4N2Si |
| Molecular Weight | 676.96 g/mol |
| Exact Mass | 676.38 |
| IUPAC Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-tetrafluorosilanuide;toluene |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1[Si-](F)(F)(F)F.Cc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C27H36F4N2Si.2C7H8/c1-17(2)21-11-9-12-22(18(3)4)25(21)32-15-16-33(27(32)34(28,29,30)31)26-23(19(5)6)13-10-14-24(26)20(7)8;2*1-7-5-3-2-4-6-7/h9-20H,1-8H3;2*2-6H,1H3 |
| InChIKey | LCQBAEOKZLNVTD-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.96 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|