C35H53IN2 — CID 46187112
2-[(E)-4,4-dimethylpent-2-en-2-yl]-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium;methane;iodide (PubChem CID 46187112) has the molecular formula C35H53IN2 and a molecular weight of 628.73 g/mol. Its IUPAC name is 2-[(E)-4,4-dimethylpent-2-en-2-yl]-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium;methane;iodide.
| Compound Name | 2-[(E)-4,4-dimethylpent-2-en-2-yl]-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium;methane;iodide |
|---|---|
| PubChem CID | 46187112 |
| Molecular Formula | C35H53IN2 |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.33 |
| IUPAC Name | 2-[(E)-4,4-dimethylpent-2-en-2-yl]-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium;methane;iodide |
| SMILES | C.C/C(=C\C(C)(C)C)c1n(-c2c(C(C)C)cccc2C(C)C)cc[n+]1-c1c(C(C)C)cccc1C(C)C.[I-] |
| InChI | InChI=1S/C34H49N2.CH4.HI/c1-22(2)27-15-13-16-28(23(3)4)31(27)35-19-20-36(33(35)26(9)21-34(10,11)12)32-29(24(5)6)17-14-18-30(32)25(7)8;;/h13-25H,1-12H3;1H4;1H/q+1;;/p-1/b26-21+;; |
| InChIKey | WLJWLLZYEBKUTM-HTQZHWFGSA-M |
| XLogP | 7.34 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|