C33H45BN2O4 — CID 139124990
trans-dimethyl (2S,3S)-1-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-boranuidacyclopropane-2,3-dicarboxylate (PubChem CID 139124990) has the molecular formula C33H45BN2O4 and a molecular weight of 544.55 g/mol. Its IUPAC name is trans-dimethyl (2S,3S)-1-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-boranuidacyclopropane-2,3-dicarboxylate.
| Compound Name | trans-dimethyl (2S,3S)-1-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-boranuidacyclopropane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 139124990 |
| Molecular Formula | C33H45BN2O4 |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.35 |
| IUPAC Name | trans-dimethyl (2S,3S)-1-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-boranuidacyclopropane-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1[BH-](c2n(-c3c(C(C)C)cccc3C(C)C)cc[n+]2-c2c(C(C)C)cccc2C(C)C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C33H45BN2O4/c1-19(2)23-13-11-14-24(20(3)4)29(23)35-17-18-36(30-25(21(5)6)15-12-16-26(30)22(7)8)33(35)34-27(31(37)39-9)28(34)32(38)40-10/h11-22,27-28,34H,1-10H3/t27-,28-/m0/s1 |
| InChIKey | GZTKGILSCBWTJA-NSOVKSMOSA-N |
| XLogP | 5.78 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|