C27H38BN3O2 — CID 139114892
[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-nitroboranuide (PubChem CID 139114892) has the molecular formula C27H38BN3O2 and a molecular weight of 447.43 g/mol. Its IUPAC name is [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-nitroboranuide.
| Compound Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-nitroboranuide |
|---|---|
| PubChem CID | 139114892 |
| Molecular Formula | C27H38BN3O2 |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-nitroboranuide |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1[BH2-][N+](=O)[O-] |
| InChI | InChI=1S/C27H38BN3O2/c1-17(2)21-11-9-12-22(18(3)4)25(21)29-15-16-30(27(29)28-31(32)33)26-23(19(5)6)13-10-14-24(26)20(7)8/h9-20H,28H2,1-8H3 |
| InChIKey | VLMQWBZAUZDPQM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 51.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|