C32H44BN5O — CID 139040216
[(3aR,6aR)-6-oxo-3a,4,5,6a-tetrahydrocyclopenta[d]triazol-3-yl]-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]boranuide (PubChem CID 139040216) has the molecular formula C32H44BN5O and a molecular weight of 525.55 g/mol. Its IUPAC name is [(3aR,6aR)-6-oxo-3a,4,5,6a-tetrahydrocyclopenta[d]triazol-3-yl]-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]boranuide.
| Compound Name | [(3aR,6aR)-6-oxo-3a,4,5,6a-tetrahydrocyclopenta[d]triazol-3-yl]-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]boranuide |
|---|---|
| PubChem CID | 139040216 |
| Molecular Formula | C32H44BN5O |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.36 |
| IUPAC Name | [(3aR,6aR)-6-oxo-3a,4,5,6a-tetrahydrocyclopenta[d]triazol-3-yl]-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]boranuide |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1[BH2-]N1N=N[C@H]2C(=O)CC[C@H]21 |
| InChI | InChI=1S/C32H44BN5O/c1-19(2)23-11-9-12-24(20(3)4)30(23)36-17-18-37(31-25(21(5)6)13-10-14-26(31)22(7)8)32(36)33-38-27-15-16-28(39)29(27)34-35-38/h9-14,17-22,27,29H,15-16,33H2,1-8H3/t27-,29-/m1/s1 |
| InChIKey | FNLXIMQDBORCIX-XRKRLSELSA-N |
| XLogP | 5.74 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|