C43H53BrN2 — CID 139191294
2-[(1S)-1,2-bis(4-methylphenyl)ethyl]-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium bromide (PubChem CID 139191294) has the molecular formula C43H53BrN2 and a molecular weight of 677.82 g/mol. Its IUPAC name is 2-[(1S)-1,2-bis(4-methylphenyl)ethyl]-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium bromide.
| Compound Name | 2-[(1S)-1,2-bis(4-methylphenyl)ethyl]-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium bromide |
|---|---|
| PubChem CID | 139191294 |
| Molecular Formula | C43H53BrN2 |
| Molecular Weight | 677.82 g/mol |
| Exact Mass | 676.34 |
| IUPAC Name | 2-[(1S)-1,2-bis(4-methylphenyl)ethyl]-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium bromide |
| SMILES | Cc1ccc(C[C@@H](c2ccc(C)cc2)c2n(-c3c(C(C)C)cccc3C(C)C)cc[n+]2-c2c(C(C)C)cccc2C(C)C)cc1.[Br-] |
| InChI | InChI=1S/C43H53N2.BrH/c1-28(2)36-13-11-14-37(29(3)4)41(36)44-25-26-45(42-38(30(5)6)15-12-16-39(42)31(7)8)43(44)40(35-23-19-33(10)20-24-35)27-34-21-17-32(9)18-22-34;/h11-26,28-31,40H,27H2,1-10H3;1H/q+1;/p-1/t40-;/m0./s1 |
| InChIKey | ZZCFVZHBYNIQDN-LMDYQTDMSA-M |
| XLogP | 8.24 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.82 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|