C57H76N6P+ — CID 154700444
bis[[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]amino]-ethynyl-methylphosphanium (PubChem CID 154700444) has the molecular formula C57H76N6P+ and a molecular weight of 876.25 g/mol. Its IUPAC name is bis[[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]amino]-ethynyl-methylphosphanium.
| Compound Name | bis[[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]amino]-ethynyl-methylphosphanium |
|---|---|
| PubChem CID | 154700444 |
| Molecular Formula | C57H76N6P+ |
| Molecular Weight | 876.25 g/mol |
| Exact Mass | 875.59 |
| IUPAC Name | bis[[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]amino]-ethynyl-methylphosphanium |
| SMILES | C#C[P+](C)(N=c1n(-c2c(C(C)C)cccc2C(C)C)ccn1-c1c(C(C)C)cccc1C(C)C)N=c1n(-c2c(C(C)C)cccc2C(C)C)ccn1-c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C57H76N6P/c1-19-64(18,58-56-60(52-44(36(2)3)24-20-25-45(52)37(4)5)32-33-61(56)53-46(38(6)7)26-21-27-47(53)39(8)9)59-57-62(54-48(40(10)11)28-22-29-49(54)41(12)13)34-35-63(57)55-50(42(14)15)30-23-31-51(55)43(16)17/h1,20-43H,2-18H3/q+1 |
| InChIKey | JCXYIMAIHRNQGQ-UHFFFAOYSA-N |
| XLogP | 15.41 |
| TPSA | 44.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.25 |
| LogP ≤ 5 | 15.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|