C12H22O2 — CID 70397314
1,2-di(propan-2-yl)benzene;dihydrate (PubChem CID 70397314) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)benzene;dihydrate.
| Compound Name | 1,2-di(propan-2-yl)benzene;dihydrate |
|---|---|
| PubChem CID | 70397314 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 1,2-di(propan-2-yl)benzene;dihydrate |
| SMILES | CC(C)c1ccccc1C(C)C.O.O |
| InChI | InChI=1S/C12H18.2H2O/c1-9(2)11-7-5-6-8-12(11)10(3)4;;/h5-10H,1-4H3;2*1H2 |
| InChIKey | GUPZOLXDJNLTEU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |