About aziridine;1,2-di(propan-2-yl)benzene
aziridine;1,2-di(propan-2-yl)benzene (PubChem CID 88841585) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is aziridine;1,2-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | aziridine;1,2-di(propan-2-yl)benzene |
| PubChem CID | 88841585 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | aziridine;1,2-di(propan-2-yl)benzene |
| SMILES | C1CN1.CC(C)c1ccccc1C(C)C |
| InChI | InChI=1S/C12H18.C2H5N/c1-9(2)11-7-5-6-8-12(11)10(3)4;1-2-3-1/h5-10H,1-4H3;3H,1-2H2 |
| InChIKey | YDVSQUMGKSBQKD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aziridine;1,2-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aziridine;1,2-di(propan-2-yl)benzene?
The IUPAC name of aziridine;1,2-di(propan-2-yl)benzene (CID 88841585) is aziridine;1,2-di(propan-2-yl)benzene.
What is the SMILES notation for aziridine;1,2-di(propan-2-yl)benzene?
The canonical SMILES for aziridine;1,2-di(propan-2-yl)benzene is C1CN1.CC(C)c1ccccc1C(C)C.
What is the InChIKey of aziridine;1,2-di(propan-2-yl)benzene?
The InChIKey is YDVSQUMGKSBQKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C2H5N/c1-9(2)11-7-5-6-8-12(11)10(3)4;1-2-3-1/h5-10H,1-4H3;3H,1-2H2.
What are the key properties of aziridine;1,2-di(propan-2-yl)benzene?
aziridine;1,2-di(propan-2-yl)benzene has a molecular weight of 205.34 g/mol, XLogP of 3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aziridine;1,2-di(propan-2-yl)benzene is sourced from PubChem (CID 88841585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).