C27H38N2Se — CID 102228013
1,3-bis[2,6-di(propan-2-yl)phenyl]imidazolidine-2-selone (PubChem CID 102228013) has the molecular formula C27H38N2Se and a molecular weight of 469.58 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]imidazolidine-2-selone.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]imidazolidine-2-selone |
|---|---|
| PubChem CID | 102228013 |
| Molecular Formula | C27H38N2Se |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]imidazolidine-2-selone |
| SMILES | CC(C)c1cccc(C(C)C)c1N1CCN(c2c(C(C)C)cccc2C(C)C)C1=[Se] |
| InChI | InChI=1S/C27H38N2Se/c1-17(2)21-11-9-12-22(18(3)4)25(21)28-15-16-29(27(28)30)26-23(19(5)6)13-10-14-24(26)20(7)8/h9-14,17-20H,15-16H2,1-8H3 |
| InChIKey | XITARVRDTZVPKF-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|