C28H40BrN2+ — CID 139156378
2-bromo-1,3-bis[2,6-di(propan-2-yl)phenyl]-5,6-dihydro-4H-pyrimidin-1-ium (PubChem CID 139156378) has the molecular formula C28H40BrN2+ and a molecular weight of 484.55 g/mol. Its IUPAC name is 2-bromo-1,3-bis[2,6-di(propan-2-yl)phenyl]-5,6-dihydro-4H-pyrimidin-1-ium.
| Compound Name | 2-bromo-1,3-bis[2,6-di(propan-2-yl)phenyl]-5,6-dihydro-4H-pyrimidin-1-ium |
|---|---|
| PubChem CID | 139156378 |
| Molecular Formula | C28H40BrN2+ |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-bromo-1,3-bis[2,6-di(propan-2-yl)phenyl]-5,6-dihydro-4H-pyrimidin-1-ium |
| SMILES | CC(C)c1cccc(C(C)C)c1N1CCC[N+](c2c(C(C)C)cccc2C(C)C)=C1Br |
| InChI | InChI=1S/C28H40BrN2/c1-18(2)22-12-9-13-23(19(3)4)26(22)30-16-11-17-31(28(30)29)27-24(20(5)6)14-10-15-25(27)21(7)8/h9-10,12-15,18-21H,11,16-17H2,1-8H3/q+1 |
| InChIKey | BWKSYWFFSIRFNZ-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|