C31H47N2+ — CID 71469337
1-[2,6-di(pentan-3-yl)phenyl]-3-[2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium (PubChem CID 71469337) has the molecular formula C31H47N2+ and a molecular weight of 447.73 g/mol. Its IUPAC name is 1-[2,6-di(pentan-3-yl)phenyl]-3-[2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium.
| Compound Name | 1-[2,6-di(pentan-3-yl)phenyl]-3-[2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 71469337 |
| Molecular Formula | C31H47N2+ |
| Molecular Weight | 447.73 g/mol |
| Exact Mass | 447.37 |
| IUPAC Name | 1-[2,6-di(pentan-3-yl)phenyl]-3-[2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium |
| SMILES | CCC(CC)c1cccc(C(CC)CC)c1[N+]1=CN(c2c(C(C)C)cccc2C(C)C)CC1 |
| InChI | InChI=1S/C31H47N2/c1-9-24(10-2)28-17-14-18-29(25(11-3)12-4)31(28)33-20-19-32(21-33)30-26(22(5)6)15-13-16-27(30)23(7)8/h13-18,21-25H,9-12,19-20H2,1-8H3/q+1 |
| InChIKey | BUGGBZBGWSORLG-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.73 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|