C24H33F6N2O3P — CID 11504844
1-[2,6-di(propan-2-yl)phenyl]-3-(2,4,6-trimethoxyphenyl)-4,5-dihydroimidazol-1-ium hexafluorophosphate (PubChem CID 11504844) has the molecular formula C24H33F6N2O3P and a molecular weight of 542.50 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(2,4,6-trimethoxyphenyl)-4,5-dihydroimidazol-1-ium hexafluorophosphate.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2,4,6-trimethoxyphenyl)-4,5-dihydroimidazol-1-ium hexafluorophosphate |
|---|---|
| PubChem CID | 11504844 |
| Molecular Formula | C24H33F6N2O3P |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2,4,6-trimethoxyphenyl)-4,5-dihydroimidazol-1-ium hexafluorophosphate |
| SMILES | COc1cc(OC)c(N2C=[N+](c3c(C(C)C)cccc3C(C)C)CC2)c(OC)c1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C24H33N2O3.F6P/c1-16(2)19-9-8-10-20(17(3)4)23(19)25-11-12-26(15-25)24-21(28-6)13-18(27-5)14-22(24)29-7;1-7(2,3,4,5)6/h8-10,13-17H,11-12H2,1-7H3;/q+1;-1 |
| InChIKey | FXZFZSNVCZTJQO-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 33.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|