About CID 159217202
CID 159217202 (PubChem CID 159217202) has the molecular formula C34H43N3O2
and a molecular weight of 525.74 g/mol.
Molecular Properties
| Compound Name | CID 159217202 |
| PubChem CID | 159217202 |
| Molecular Formula | C34H43N3O2 |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 525.34 |
| IUPAC Name | — |
| SMILES | COc1cccc(OC)c1-c1[c-][n+](-c2c(C(C)C)cccc2C(C)C)nn1-c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C34H43N3O2/c1-21(2)25-14-11-15-26(22(3)4)33(25)36-20-29(32-30(38-9)18-13-19-31(32)39-10)37(35-36)34-27(23(5)6)16-12-17-28(34)24(7)8/h11-19,21-24H,1-10H3 |
| InChIKey | AZNKAHRDQBNOLK-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 159217202 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159217202?
The IUPAC name of CID 159217202 (CID 159217202) is not available.
What is the SMILES notation for CID 159217202?
The canonical SMILES for CID 159217202 is COc1cccc(OC)c1-c1[c-][n+](-c2c(C(C)C)cccc2C(C)C)nn1-c1c(C(C)C)cccc1C(C)C.
What is the InChIKey of CID 159217202?
The InChIKey is AZNKAHRDQBNOLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H43N3O2/c1-21(2)25-14-11-15-26(22(3)4)33(25)36-20-29(32-30(38-9)18-13-19-31(32)39-10)37(35-36)34-27(23(5)6)16-12-17-28(34)24(7)8/h11-19,21-24H,1-10H3.
What are the key properties of CID 159217202?
CID 159217202 has a molecular weight of 525.74 g/mol, XLogP of 8.13, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159217202 is sourced from PubChem (CID 159217202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).