C24H33N2O+ — CID 102419166
1-[2,6-di(propan-2-yl)phenyl]-3-(2-methoxyphenyl)-4,5,6,7-tetrahydro-1,3-diazepin-1-ium (PubChem CID 102419166) has the molecular formula C24H33N2O+ and a molecular weight of 365.54 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(2-methoxyphenyl)-4,5,6,7-tetrahydro-1,3-diazepin-1-ium.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2-methoxyphenyl)-4,5,6,7-tetrahydro-1,3-diazepin-1-ium |
|---|---|
| PubChem CID | 102419166 |
| Molecular Formula | C24H33N2O+ |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2-methoxyphenyl)-4,5,6,7-tetrahydro-1,3-diazepin-1-ium |
| SMILES | COc1ccccc1N1C=[N+](c2c(C(C)C)cccc2C(C)C)CCCC1 |
| InChI | InChI=1S/C24H33N2O/c1-18(2)20-11-10-12-21(19(3)4)24(20)26-16-9-8-15-25(17-26)22-13-6-7-14-23(22)27-5/h6-7,10-14,17-19H,8-9,15-16H2,1-5H3/q+1 |
| InChIKey | LNYIIUGFJNWEMW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|