C24H33N2O+ — CID 102348192
(2S)-2-[3-[2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium-1-yl]-3-phenylpropan-1-ol (PubChem CID 102348192) has the molecular formula C24H33N2O+ and a molecular weight of 365.54 g/mol. Its IUPAC name is (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium-1-yl]-3-phenylpropan-1-ol.
| Compound Name | (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium-1-yl]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 102348192 |
| Molecular Formula | C24H33N2O+ |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | (2S)-2-[3-[2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium-1-yl]-3-phenylpropan-1-ol |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C=[N+]([C@H](CO)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H33N2O/c1-18(2)22-11-8-12-23(19(3)4)24(22)26-14-13-25(17-26)21(16-27)15-20-9-6-5-7-10-20/h5-12,17-19,21,27H,13-16H2,1-4H3/q+1/t21-/m0/s1 |
| InChIKey | VMSVVZZGIVWKQX-NRFANRHFSA-N |
| XLogP | 4.40 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|