C26H30N3O+ — CID 58031059
2-benzyl-3-(1,3-dimethyl-4,5-diphenyltriazolidin-2-ium-2-ylidene)propan-1-ol (PubChem CID 58031059) has the molecular formula C26H30N3O+ and a molecular weight of 400.55 g/mol. Its IUPAC name is 2-benzyl-3-(1,3-dimethyl-4,5-diphenyltriazolidin-2-ium-2-ylidene)propan-1-ol.
| Compound Name | 2-benzyl-3-(1,3-dimethyl-4,5-diphenyltriazolidin-2-ium-2-ylidene)propan-1-ol |
|---|---|
| PubChem CID | 58031059 |
| Molecular Formula | C26H30N3O+ |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 2-benzyl-3-(1,3-dimethyl-4,5-diphenyltriazolidin-2-ium-2-ylidene)propan-1-ol |
| SMILES | CN1C(c2ccccc2)C(c2ccccc2)N(C)[N+]1=CC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C26H30N3O/c1-27-25(23-14-8-4-9-15-23)26(24-16-10-5-11-17-24)28(2)29(27)19-22(20-30)18-21-12-6-3-7-13-21/h3-17,19,22,25-26,30H,18,20H2,1-2H3/q+1 |
| InChIKey | GTPJLMKDKVRIKY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|