C20H25N3O — CID 123724697
2-[(1,3-dimethyl-4,5-diphenylimidazolidin-2-ylidene)amino]propan-1-ol (PubChem CID 123724697) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-4,5-diphenylimidazolidin-2-ylidene)amino]propan-1-ol.
| Compound Name | 2-[(1,3-dimethyl-4,5-diphenylimidazolidin-2-ylidene)amino]propan-1-ol |
|---|---|
| PubChem CID | 123724697 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 2-[(1,3-dimethyl-4,5-diphenylimidazolidin-2-ylidene)amino]propan-1-ol |
| SMILES | CC(CO)N=C1N(C)C(c2ccccc2)C(c2ccccc2)N1C |
| InChI | InChI=1S/C20H25N3O/c1-15(14-24)21-20-22(2)18(16-10-6-4-7-11-16)19(23(20)3)17-12-8-5-9-13-17/h4-13,15,18-19,24H,14H2,1-3H3 |
| InChIKey | LZFVQTXUZNHEOE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|