C17H18N3- — CID 162358368
(1,3-dimethyl-4,5-diphenylimidazolidin-2-ylidene)azanide (PubChem CID 162358368) has the molecular formula C17H18N3- and a molecular weight of 264.35 g/mol. Its IUPAC name is (1,3-dimethyl-4,5-diphenylimidazolidin-2-ylidene)azanide.
| Compound Name | (1,3-dimethyl-4,5-diphenylimidazolidin-2-ylidene)azanide |
|---|---|
| PubChem CID | 162358368 |
| Molecular Formula | C17H18N3- |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (1,3-dimethyl-4,5-diphenylimidazolidin-2-ylidene)azanide |
| SMILES | CN1C(=[N-])N(C)C(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C17H18N3/c1-19-15(13-9-5-3-6-10-13)16(20(2)17(19)18)14-11-7-4-8-12-14/h3-12,15-16H,1-2H3/q-1 |
| InChIKey | MFYZWQGDGMCASR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 28.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|