C24H36N4 — CID 10667503
trans-(2S,3S)-1,4,7,10-tetramethyl-2,3-diphenyl-1,4,7,10-tetrazacyclododecane (PubChem CID 10667503) has the molecular formula C24H36N4 and a molecular weight of 380.58 g/mol. Its IUPAC name is trans-(2S,3S)-1,4,7,10-tetramethyl-2,3-diphenyl-1,4,7,10-tetrazacyclododecane.
| Compound Name | trans-(2S,3S)-1,4,7,10-tetramethyl-2,3-diphenyl-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 10667503 |
| Molecular Formula | C24H36N4 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | trans-(2S,3S)-1,4,7,10-tetramethyl-2,3-diphenyl-1,4,7,10-tetrazacyclododecane |
| SMILES | CN1CCN(C)CCN(C)[C@@H](c2ccccc2)[C@H](c2ccccc2)N(C)CC1 |
| InChI | InChI=1S/C24H36N4/c1-25-15-16-26(2)18-20-28(4)24(22-13-9-6-10-14-22)23(27(3)19-17-25)21-11-7-5-8-12-21/h5-14,23-24H,15-20H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | DKQVGZATEQLFMW-ZEQRLZLVSA-N |
| XLogP | 3.21 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |