C12H19IN2 — CID 168921950
1,4-dimethyl-2-phenylpiperazine;hydroiodide (PubChem CID 168921950) has the molecular formula C12H19IN2 and a molecular weight of 318.20 g/mol. Its IUPAC name is 1,4-dimethyl-2-phenylpiperazine;hydroiodide.
| Compound Name | 1,4-dimethyl-2-phenylpiperazine;hydroiodide |
|---|---|
| PubChem CID | 168921950 |
| Molecular Formula | C12H19IN2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1,4-dimethyl-2-phenylpiperazine;hydroiodide |
| SMILES | CN1CCN(C)C(c2ccccc2)C1.I |
| InChI | InChI=1S/C12H18N2.HI/c1-13-8-9-14(2)12(10-13)11-6-4-3-5-7-11;/h3-7,12H,8-10H2,1-2H3;1H |
| InChIKey | BSSSBHLFHWDCMV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|