C13H21N3O2S — CID 124669879
(3R)-N,N,4-trimethyl-3-phenylpiperazine-1-sulfonamide (PubChem CID 124669879) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is (3R)-N,N,4-trimethyl-3-phenylpiperazine-1-sulfonamide.
| Compound Name | (3R)-N,N,4-trimethyl-3-phenylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 124669879 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (3R)-N,N,4-trimethyl-3-phenylpiperazine-1-sulfonamide |
| SMILES | CN1CCN(S(=O)(=O)N(C)C)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H21N3O2S/c1-14(2)19(17,18)16-10-9-15(3)13(11-16)12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | NETBFVDUJWWESV-ZDUSSCGKSA-N |
| XLogP | 0.78 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |