C16H15NO — CID 122372873
(3R,4S)-1-methyl-3,4-diphenylazetidin-2-one (PubChem CID 122372873) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is (3R,4S)-1-methyl-3,4-diphenylazetidin-2-one.
| Compound Name | (3R,4S)-1-methyl-3,4-diphenylazetidin-2-one |
|---|---|
| PubChem CID | 122372873 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (3R,4S)-1-methyl-3,4-diphenylazetidin-2-one |
| SMILES | CN1C(=O)[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H15NO/c1-17-15(13-10-6-3-7-11-13)14(16(17)18)12-8-4-2-5-9-12/h2-11,14-15H,1H3/t14-,15-/m1/s1 |
| InChIKey | OMCDVIXQBXCPRC-HUUCEWRRSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |