C16H16N2O — CID 11831915
(4S,5S)-1-methyl-4,5-diphenylimidazolidin-2-one (PubChem CID 11831915) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is (4S,5S)-1-methyl-4,5-diphenylimidazolidin-2-one.
| Compound Name | (4S,5S)-1-methyl-4,5-diphenylimidazolidin-2-one |
|---|---|
| PubChem CID | 11831915 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (4S,5S)-1-methyl-4,5-diphenylimidazolidin-2-one |
| SMILES | CN1C(=O)N[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H16N2O/c1-18-15(13-10-6-3-7-11-13)14(17-16(18)19)12-8-4-2-5-9-12/h2-11,14-15H,1H3,(H,17,19)/t14-,15-/m0/s1 |
| InChIKey | ONGFAUXECFNINH-GJZGRUSLSA-N |
| XLogP | 3.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |