C10H10FNO — CID 14984605
(3R,4R)-3-fluoro-1-methyl-4-phenylazetidin-2-one (PubChem CID 14984605) has the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. Its IUPAC name is (3R,4R)-3-fluoro-1-methyl-4-phenylazetidin-2-one.
| Compound Name | (3R,4R)-3-fluoro-1-methyl-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 14984605 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | (3R,4R)-3-fluoro-1-methyl-4-phenylazetidin-2-one |
| SMILES | CN1C(=O)[C@H](F)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C10H10FNO/c1-12-9(8(11)10(12)13)7-5-3-2-4-6-7/h2-6,8-9H,1H3/t8-,9-/m1/s1 |
| InChIKey | JXOYGCCNFKEQCA-RKDXNWHRSA-N |
| XLogP | 1.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |