C19H21NO — CID 135070728
(3R,4S)-1-tert-butyl-3,4-diphenylazetidin-2-one (PubChem CID 135070728) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (3R,4S)-1-tert-butyl-3,4-diphenylazetidin-2-one.
| Compound Name | (3R,4S)-1-tert-butyl-3,4-diphenylazetidin-2-one |
|---|---|
| PubChem CID | 135070728 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (3R,4S)-1-tert-butyl-3,4-diphenylazetidin-2-one |
| SMILES | CC(C)(C)N1C(=O)[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H21NO/c1-19(2,3)20-17(15-12-8-5-9-13-15)16(18(20)21)14-10-6-4-7-11-14/h4-13,16-17H,1-3H3/t16-,17-/m1/s1 |
| InChIKey | XYWVUAPFXWBRTO-IAGOWNOFSA-N |
| XLogP | 4.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |