C19H21NO — CID 14925845
1-[(2S,3R)-2,3-diphenylaziridin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 14925845) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-[(2S,3R)-2,3-diphenylaziridin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(2S,3R)-2,3-diphenylaziridin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 14925845 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-[(2S,3R)-2,3-diphenylaziridin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H21NO/c1-19(2,3)18(21)20-16(14-10-6-4-7-11-14)17(20)15-12-8-5-9-13-15/h4-13,16-17H,1-3H3/t16-,17+,20? |
| InChIKey | SFJLFAMSXLYQNJ-XEWABKELSA-N |
| XLogP | 4.36 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|