C16H15NO — CID 12739484
[(2S,3R)-2-methyl-3-phenylaziridin-1-yl]-phenylmethanone (PubChem CID 12739484) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is [(2S,3R)-2-methyl-3-phenylaziridin-1-yl]-phenylmethanone.
| Compound Name | [(2S,3R)-2-methyl-3-phenylaziridin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 12739484 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | [(2S,3R)-2-methyl-3-phenylaziridin-1-yl]-phenylmethanone |
| SMILES | C[C@H]1[C@@H](c2ccccc2)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H15NO/c1-12-15(13-8-4-2-5-9-13)17(12)16(18)14-10-6-3-7-11-14/h2-12,15H,1H3/t12-,15-,17?/m0/s1 |
| InChIKey | WPJDAFJBLSBPNG-BOFKDWQUSA-N |
| XLogP | 3.27 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|