C22H24N2O2 — CID 102506692
[(3aS,7aS)-3-benzoyl-2-methyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]-phenylmethanone (PubChem CID 102506692) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is [(3aS,7aS)-3-benzoyl-2-methyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]-phenylmethanone.
| Compound Name | [(3aS,7aS)-3-benzoyl-2-methyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 102506692 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | [(3aS,7aS)-3-benzoyl-2-methyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]-phenylmethanone |
| SMILES | CC1N(C(=O)c2ccccc2)[C@H]2CCCC[C@@H]2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O2/c1-16-23(21(25)17-10-4-2-5-11-17)19-14-8-9-15-20(19)24(16)22(26)18-12-6-3-7-13-18/h2-7,10-13,16,19-20H,8-9,14-15H2,1H3/t19-,20-/m0/s1 |
| InChIKey | VLJVOPOONDHEFP-PMACEKPBSA-N |
| XLogP | 3.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |