About [(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone
[(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone (PubChem CID 15379256) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is [(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone |
| PubChem CID | 15379256 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | [(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1[C@@H]2CC[C@H]1C2O |
| InChI | InChI=1S/C12H13NO2/c14-11-9-6-7-10(11)13(9)12(15)8-4-2-1-3-5-8/h1-5,9-11,14H,6-7H2/t9-,10+,11? |
| InChIKey | CBKJKPYTBPMLFF-ZACCUICWSA-N |
| XLogP | 1.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone?
The IUPAC name of [(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone (CID 15379256) is [(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone.
What is the SMILES notation for [(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone?
The canonical SMILES for [(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone is O=C(c1ccccc1)N1[C@@H]2CC[C@H]1C2O.
What is the InChIKey of [(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone?
The InChIKey is CBKJKPYTBPMLFF-ZACCUICWSA-N. The full InChI is InChI=1S/C12H13NO2/c14-11-9-6-7-10(11)13(9)12(15)8-4-2-1-3-5-8/h1-5,9-11,14H,6-7H2/t9-,10+,11?.
What are the key properties of [(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone?
[(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone has a molecular weight of 203.24 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,4S)-6-hydroxy-5-azabicyclo[2.1.1]hexan-5-yl]-phenylmethanone is sourced from PubChem (CID 15379256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).