C21H26N2O — CID 129268177
[(2R,6S)-4-(4-ethylphenyl)-2,6-dimethylpiperazin-1-yl]-phenylmethanone (PubChem CID 129268177) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is [(2R,6S)-4-(4-ethylphenyl)-2,6-dimethylpiperazin-1-yl]-phenylmethanone.
| Compound Name | [(2R,6S)-4-(4-ethylphenyl)-2,6-dimethylpiperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 129268177 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | [(2R,6S)-4-(4-ethylphenyl)-2,6-dimethylpiperazin-1-yl]-phenylmethanone |
| SMILES | CCc1ccc(N2C[C@@H](C)N(C(=O)c3ccccc3)[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C21H26N2O/c1-4-18-10-12-20(13-11-18)22-14-16(2)23(17(3)15-22)21(24)19-8-6-5-7-9-19/h5-13,16-17H,4,14-15H2,1-3H3/t16-,17+ |
| InChIKey | VJBHSKCRTDZQRB-CALCHBBNSA-N |
| XLogP | 3.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|