C18H21N3OS — CID 126518368
[2,6-dimethyl-4-(4-sulfanylphenyl)piperazin-1-yl]-pyridin-4-ylmethanone (PubChem CID 126518368) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is [2,6-dimethyl-4-(4-sulfanylphenyl)piperazin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [2,6-dimethyl-4-(4-sulfanylphenyl)piperazin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 126518368 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [2,6-dimethyl-4-(4-sulfanylphenyl)piperazin-1-yl]-pyridin-4-ylmethanone |
| SMILES | CC1CN(c2ccc(S)cc2)CC(C)N1C(=O)c1ccncc1 |
| InChI | InChI=1S/C18H21N3OS/c1-13-11-20(16-3-5-17(23)6-4-16)12-14(2)21(13)18(22)15-7-9-19-10-8-15/h3-10,13-14,23H,11-12H2,1-2H3 |
| InChIKey | XDSRXTABKSCEOA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 36.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|