C26H36N4O2 — CID 59250190
[(2R,6S)-2,6-dimethyl-4-[4-(3-piperidin-1-ylpropoxy)phenyl]piperazin-1-yl]-pyridin-4-ylmethanone (PubChem CID 59250190) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is [(2R,6S)-2,6-dimethyl-4-[4-(3-piperidin-1-ylpropoxy)phenyl]piperazin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [(2R,6S)-2,6-dimethyl-4-[4-(3-piperidin-1-ylpropoxy)phenyl]piperazin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 59250190 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | [(2R,6S)-2,6-dimethyl-4-[4-(3-piperidin-1-ylpropoxy)phenyl]piperazin-1-yl]-pyridin-4-ylmethanone |
| SMILES | C[C@@H]1CN(c2ccc(OCCCN3CCCCC3)cc2)C[C@H](C)N1C(=O)c1ccncc1 |
| InChI | InChI=1S/C26H36N4O2/c1-21-19-29(20-22(2)30(21)26(31)23-11-13-27-14-12-23)24-7-9-25(10-8-24)32-18-6-17-28-15-4-3-5-16-28/h7-14,21-22H,3-6,15-20H2,1-2H3/t21-,22+ |
| InChIKey | JNBAZWBGNUCVGA-SZPZYZBQSA-N |
| XLogP | 4.08 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|