C27H37N3O2 — CID 10320792
[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone (PubChem CID 10320792) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is [3-methyl-4-(3-methylphenyl)piperazin-1-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone.
| Compound Name | [3-methyl-4-(3-methylphenyl)piperazin-1-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 10320792 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | [3-methyl-4-(3-methylphenyl)piperazin-1-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3ccc(OCCCN4CCCCC4)cc3)CC2C)c1 |
| InChI | InChI=1S/C27H37N3O2/c1-22-8-6-9-25(20-22)30-18-17-29(21-23(30)2)27(31)24-10-12-26(13-11-24)32-19-7-16-28-14-4-3-5-15-28/h6,8-13,20,23H,3-5,7,14-19,21H2,1-2H3 |
| InChIKey | DGKRTWISVYCSQH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|