C27H32ClN3O3 — CID 10345141
[(1S,4S)-5-(4-chlorobenzoyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone (PubChem CID 10345141) has the molecular formula C27H32ClN3O3 and a molecular weight of 482.02 g/mol. Its IUPAC name is [(1S,4S)-5-(4-chlorobenzoyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone.
| Compound Name | [(1S,4S)-5-(4-chlorobenzoyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 10345141 |
| Molecular Formula | C27H32ClN3O3 |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | [(1S,4S)-5-(4-chlorobenzoyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1C[C@@H]2C[C@H]1CN2C(=O)c1ccc(OCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C27H32ClN3O3/c28-22-9-5-20(6-10-22)26(32)30-18-24-17-23(30)19-31(24)27(33)21-7-11-25(12-8-21)34-16-4-15-29-13-2-1-3-14-29/h5-12,23-24H,1-4,13-19H2/t23-,24-/m0/s1 |
| InChIKey | ILNDZHMBJFOZNW-ZEQRLZLVSA-N |
| XLogP | 4.33 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|