C14H19NO2 — CID 7329928
[(2S,4S,5R)-4-hydroxy-2,5-dimethylpiperidin-1-yl]-phenylmethanone (PubChem CID 7329928) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is [(2S,4S,5R)-4-hydroxy-2,5-dimethylpiperidin-1-yl]-phenylmethanone.
| Compound Name | [(2S,4S,5R)-4-hydroxy-2,5-dimethylpiperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 7329928 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | [(2S,4S,5R)-4-hydroxy-2,5-dimethylpiperidin-1-yl]-phenylmethanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccccc2)[C@@H](C)C[C@@H]1O |
| InChI | InChI=1S/C14H19NO2/c1-10-9-15(11(2)8-13(10)16)14(17)12-6-4-3-5-7-12/h3-7,10-11,13,16H,8-9H2,1-2H3/t10-,11+,13+/m1/s1 |
| InChIKey | GXJNSARMQFFFQL-MDZLAQPJSA-N |
| XLogP | 1.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |