C20H20N2O3 — CID 45141410
[(2S,4S)-2-methyl-4-[(E)-2-phenylethenyl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 45141410) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is [(2S,4S)-2-methyl-4-[(E)-2-phenylethenyl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [(2S,4S)-2-methyl-4-[(E)-2-phenylethenyl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 45141410 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [(2S,4S)-2-methyl-4-[(E)-2-phenylethenyl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | C[C@H]1C[C@@H](/C=C/c2ccccc2)CN1C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20N2O3/c1-15-13-17(8-7-16-5-3-2-4-6-16)14-21(15)20(23)18-9-11-19(12-10-18)22(24)25/h2-12,15,17H,13-14H2,1H3/b8-7+/t15-,17+/m0/s1 |
| InChIKey | XSIMYKSFMDWIQA-CRLUXQHQSA-N |
| XLogP | 4.16 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|