C41H38N2O7 — CID 164740784
[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-[4-[(E)-2-(4-nitrophenyl)ethenyl]phenyl]methanone (PubChem CID 164740784) has the molecular formula C41H38N2O7 and a molecular weight of 670.76 g/mol. Its IUPAC name is [(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-[4-[(E)-2-(4-nitrophenyl)ethenyl]phenyl]methanone.
| Compound Name | [(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-[4-[(E)-2-(4-nitrophenyl)ethenyl]phenyl]methanone |
|---|---|
| PubChem CID | 164740784 |
| Molecular Formula | C41H38N2O7 |
| Molecular Weight | 670.76 g/mol |
| Exact Mass | 670.27 |
| IUPAC Name | [(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-[4-[(E)-2-(4-nitrophenyl)ethenyl]phenyl]methanone |
| SMILES | COc1ccc(C(OC[C@@H]2C[C@@H](O)CN2C(=O)c2ccc(/C=C/c3ccc([N+](=O)[O-])cc3)cc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H38N2O7/c1-48-38-22-16-33(17-23-38)41(32-6-4-3-5-7-32,34-18-24-39(49-2)25-19-34)50-28-36-26-37(44)27-42(36)40(45)31-14-10-29(11-15-31)8-9-30-12-20-35(21-13-30)43(46)47/h3-25,36-37,44H,26-28H2,1-2H3/b9-8+/t36-,37+/m0/s1 |
| InChIKey | YMKMABDFOCNTBE-PGVUOVTNSA-N |
| XLogP | 7.37 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.76 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|