C35H43NO6 — CID 157098843
1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]nonane-1,8-dione (PubChem CID 157098843) has the molecular formula C35H43NO6 and a molecular weight of 573.73 g/mol. Its IUPAC name is 1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]nonane-1,8-dione.
| Compound Name | 1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]nonane-1,8-dione |
|---|---|
| PubChem CID | 157098843 |
| Molecular Formula | C35H43NO6 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | 1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]nonane-1,8-dione |
| SMILES | COc1ccc(C(OC[C@@H]2C[C@@H](O)CN2C(=O)CCCCCCC(C)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H43NO6/c1-26(37)11-7-4-5-10-14-34(39)36-24-31(38)23-30(36)25-42-35(27-12-8-6-9-13-27,28-15-19-32(40-2)20-16-28)29-17-21-33(41-3)22-18-29/h6,8-9,12-13,15-22,30-31,38H,4-5,7,10-11,14,23-25H2,1-3H3/t30-,31+/m0/s1 |
| InChIKey | ZQRILNPXBMEWGM-IOWSJCHKSA-N |
| XLogP | 5.90 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|