C34H36N2O5S2 — CID 59545197
1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-3-(pyridin-2-yldisulfanyl)propan-1-one (PubChem CID 59545197) has the molecular formula C34H36N2O5S2 and a molecular weight of 616.81 g/mol. Its IUPAC name is 1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-3-(pyridin-2-yldisulfanyl)propan-1-one.
| Compound Name | 1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-3-(pyridin-2-yldisulfanyl)propan-1-one |
|---|---|
| PubChem CID | 59545197 |
| Molecular Formula | C34H36N2O5S2 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | 1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-3-(pyridin-2-yldisulfanyl)propan-1-one |
| SMILES | COc1ccc(C(OC[C@@H]2C[C@@H](O)CN2C(=O)CCSSc2ccccn2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H36N2O5S2/c1-39-30-15-11-26(12-16-30)34(25-8-4-3-5-9-25,27-13-17-31(40-2)18-14-27)41-24-28-22-29(37)23-36(28)33(38)19-21-42-43-32-10-6-7-20-35-32/h3-18,20,28-29,37H,19,21-24H2,1-2H3/t28-,29+/m0/s1 |
| InChIKey | ZAGZZDSSNVQDMH-URLMMPGGSA-N |
| XLogP | 6.20 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|