C34H46N2O5 — CID 91121752
6-amino-1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]hexan-1-one;ethane (PubChem CID 91121752) has the molecular formula C34H46N2O5 and a molecular weight of 562.75 g/mol. Its IUPAC name is 6-amino-1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]hexan-1-one;ethane.
| Compound Name | 6-amino-1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]hexan-1-one;ethane |
|---|---|
| PubChem CID | 91121752 |
| Molecular Formula | C34H46N2O5 |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.34 |
| IUPAC Name | 6-amino-1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]hexan-1-one;ethane |
| SMILES | CC.COc1ccc(C(OC[C@@H]2C[C@@H](O)CN2C(=O)CCCCCN)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H40N2O5.C2H6/c1-37-29-16-12-25(13-17-29)32(24-9-5-3-6-10-24,26-14-18-30(38-2)19-15-26)39-23-27-21-28(35)22-34(27)31(36)11-7-4-8-20-33;1-2/h3,5-6,9-10,12-19,27-28,35H,4,7-8,11,20-23,33H2,1-2H3;1-2H3/t27-,28+;/m0./s1 |
| InChIKey | ODPGULMCHDDVAT-DUZWKJOOSA-N |
| XLogP | 5.52 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|