C48H41NO5 — CID 15868042
1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-2-perylen-3-ylethanone (PubChem CID 15868042) has the molecular formula C48H41NO5 and a molecular weight of 711.86 g/mol. Its IUPAC name is 1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-2-perylen-3-ylethanone.
| Compound Name | 1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-2-perylen-3-ylethanone |
|---|---|
| PubChem CID | 15868042 |
| Molecular Formula | C48H41NO5 |
| Molecular Weight | 711.86 g/mol |
| Exact Mass | 711.30 |
| IUPAC Name | 1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-2-perylen-3-ylethanone |
| SMILES | COc1ccc(C(OC[C@@H]2C[C@@H](O)CN2C(=O)Cc2ccc3c4cccc5cccc(c6cccc2c63)c54)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C48H41NO5/c1-52-38-22-18-34(19-23-38)48(33-11-4-3-5-12-33,35-20-24-39(53-2)25-21-35)54-30-36-28-37(50)29-49(36)45(51)27-32-17-26-44-42-15-7-10-31-9-6-14-41(46(31)42)43-16-8-13-40(32)47(43)44/h3-26,36-37,50H,27-30H2,1-2H3/t36-,37+/m0/s1 |
| InChIKey | DOBIWZSBXAPEMA-PQQNNWGCSA-N |
| XLogP | 9.27 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.86 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|