C36H45NO6 — CID 176754653
10-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-10-oxodecanal (PubChem CID 176754653) has the molecular formula C36H45NO6 and a molecular weight of 587.76 g/mol. Its IUPAC name is 10-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-10-oxodecanal.
| Compound Name | 10-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-10-oxodecanal |
|---|---|
| PubChem CID | 176754653 |
| Molecular Formula | C36H45NO6 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.32 |
| IUPAC Name | 10-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-10-oxodecanal |
| SMILES | COc1ccc(C(OC[C@@H]2C[C@@H](O)CN2C(=O)CCCCCCCCC=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H45NO6/c1-41-33-20-16-29(17-21-33)36(28-13-9-8-10-14-28,30-18-22-34(42-2)23-19-30)43-27-31-25-32(39)26-37(31)35(40)15-11-6-4-3-5-7-12-24-38/h8-10,13-14,16-24,31-32,39H,3-7,11-12,15,25-27H2,1-2H3/t31-,32+/m0/s1 |
| InChIKey | MZWFCDHSXQYGGM-AJQTZOPKSA-N |
| XLogP | 6.29 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|