C37H49NO6 — CID 176754642
10-[(2S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(hydroxymethyl)morpholin-4-yl]decanal (PubChem CID 176754642) has the molecular formula C37H49NO6 and a molecular weight of 603.80 g/mol. Its IUPAC name is 10-[(2S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(hydroxymethyl)morpholin-4-yl]decanal.
| Compound Name | 10-[(2S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(hydroxymethyl)morpholin-4-yl]decanal |
|---|---|
| PubChem CID | 176754642 |
| Molecular Formula | C37H49NO6 |
| Molecular Weight | 603.80 g/mol |
| Exact Mass | 603.36 |
| IUPAC Name | 10-[(2S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(hydroxymethyl)morpholin-4-yl]decanal |
| SMILES | COc1ccc(C(OC[C@@H]2CN(CCCCCCCCCC=O)CC(CO)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H49NO6/c1-41-33-20-16-31(17-21-33)37(30-14-10-9-11-15-30,32-18-22-34(42-2)23-19-32)43-29-36-27-38(26-35(28-40)44-36)24-12-7-5-3-4-6-8-13-25-39/h9-11,14-23,25,35-36,40H,3-8,12-13,24,26-29H2,1-2H3/t35?,36-/m0/s1 |
| InChIKey | HCFSOHVKALKTTC-UHBYFKDRSA-N |
| XLogP | 6.39 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.80 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|