C37H47NO8 — CID 176754703
10-[(2S,6S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(hydroxymethyl)morpholin-4-yl]-10-oxodecanoic acid (PubChem CID 176754703) has the molecular formula C37H47NO8 and a molecular weight of 633.78 g/mol. Its IUPAC name is 10-[(2S,6S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(hydroxymethyl)morpholin-4-yl]-10-oxodecanoic acid.
| Compound Name | 10-[(2S,6S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(hydroxymethyl)morpholin-4-yl]-10-oxodecanoic acid |
|---|---|
| PubChem CID | 176754703 |
| Molecular Formula | C37H47NO8 |
| Molecular Weight | 633.78 g/mol |
| Exact Mass | 633.33 |
| IUPAC Name | 10-[(2S,6S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(hydroxymethyl)morpholin-4-yl]-10-oxodecanoic acid |
| SMILES | COc1ccc(C(OC[C@@H]2CN(C(=O)CCCCCCCCC(=O)O)C[C@@H](CO)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H47NO8/c1-43-31-20-16-29(17-21-31)37(28-12-8-7-9-13-28,30-18-22-32(44-2)23-19-30)45-27-34-25-38(24-33(26-39)46-34)35(40)14-10-5-3-4-6-11-15-36(41)42/h7-9,12-13,16-23,33-34,39H,3-6,10-11,14-15,24-27H2,1-2H3,(H,41,42)/t33-,34-/m0/s1 |
| InChIKey | YDAYRIXPSZJEAW-HEVIKAOCSA-N |
| XLogP | 5.81 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.78 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|