C36H43NO9 — CID 145481231
4-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-1-(6-hydroxyhexanoyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid (PubChem CID 145481231) has the molecular formula C36H43NO9 and a molecular weight of 633.74 g/mol. Its IUPAC name is 4-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-1-(6-hydroxyhexanoyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-1-(6-hydroxyhexanoyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 145481231 |
| Molecular Formula | C36H43NO9 |
| Molecular Weight | 633.74 g/mol |
| Exact Mass | 633.29 |
| IUPAC Name | 4-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-1-(6-hydroxyhexanoyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid |
| SMILES | COc1ccc(C(OCC2CN(C(=O)CCCCCO)CC2OC(=O)CCC(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H43NO9/c1-43-30-16-12-28(13-17-30)36(27-9-5-3-6-10-27,29-14-18-31(44-2)19-15-29)45-25-26-23-37(33(39)11-7-4-8-22-38)24-32(26)46-35(42)21-20-34(40)41/h3,5-6,9-10,12-19,26,32,38H,4,7-8,11,20-25H2,1-2H3,(H,40,41) |
| InChIKey | FHBYZSLBRMBWHW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.74 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|